Type: Neutral
Formula: C20H23N5O2S
SMILES: |
s1c2n(nc(c2cc1C(=O)NNC(=O)NC1CCCCC1)C)-c1ccccc1 |
InChI: |
InChI=1/C20H23N5O2S/c1-13-16-12-17(28-19(16)25(24-13)15-10-6-3-7-11-15)18(26)22-23-20(27)21-14-8-4-2-5-9-14/h3,6-7,10-12,14H,2,4-5,8-9H2,1H3,(H,22,26)(H2,21,23,27) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 397.503 g/mol | logS: -6.01301 | SlogP: 3.67212 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0296333 | Sterimol/B1: 2.94804 | Sterimol/B2: 3.25431 | Sterimol/B3: 3.66109 |
Sterimol/B4: 10.0069 | Sterimol/L: 17.3511 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 679.606 | Positive charged surface: 396.517 | Negative charged surface: 277.412 | Volume: 370.125 |
Hydrophobic surface: 552.927 | Hydrophilic surface: 126.679 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |