Type: Neutral
Formula: C10H18O6P2
SMILES: |
P(O)(O)(=O)C12CC3(P(O)(O)=O)CC(C1)CC(C2)C3 |
InChI: |
InChI=1/C10H18O6P2/c11-17(12,13)9-2-7-1-8(4-9)5-10(3-7,6-9)18(14,15)16/h7-8H,1-6H2,(H2,11,12,13)(H2,14,15,16)/t7-,8+,9+,10- |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 296.196 g/mol | logS: -0.37475 | SlogP: -0.7072 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.332369 | Sterimol/B1: 2.11412 | Sterimol/B2: 3.74305 | Sterimol/B3: 3.74318 |
Sterimol/B4: 6.41141 | Sterimol/L: 12.3269 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 426.701 | Positive charged surface: 265.285 | Negative charged surface: 161.415 | Volume: 232.5 |
Hydrophobic surface: 192.125 | Hydrophilic surface: 234.576 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |