Type: Neutral
Formula: C17H26N2O2
SMILES: |
OCC(NC(=O)NC(C)(C)c1cc(ccc1)C(C)=C)CC |
InChI: |
InChI=1/C17H26N2O2/c1-6-15(11-20)18-16(21)19-17(4,5)14-9-7-8-13(10-14)12(2)3/h7-10,15,20H,2,6,11H2,1,3-5H3,(H2,18,19,21)/t15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 290.407 g/mol | logS: -3.78018 | SlogP: 3.3364 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.123747 | Sterimol/B1: 2.57496 | Sterimol/B2: 3.00316 | Sterimol/B3: 5.9458 |
Sterimol/B4: 7.3639 | Sterimol/L: 14.3003 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 589.667 | Positive charged surface: 400.067 | Negative charged surface: 189.6 | Volume: 312.25 |
Hydrophobic surface: 424.652 | Hydrophilic surface: 165.015 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |