 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(N)c1ccc(cc1)CCNC(=O)COC(=O)c1cn(nc1-c1cc(OC)ccc1)- c1ccccc1 |
| InChI: | InChI=1/C27H26N4O6S/c1-36-22-9-5-6-20(16-22)26-24(17-31(30-26)21-7-3-2-4-8-21)27(33)37-18-25(32)29-15-14-19-10-12-23(13-11-19)38(28,34)35/h2-13,16-17H,14-15,18H2,1H3,(H,29,32)(H2,28,34,35) |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=105.641 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 534.593 g/mol | logS: -6.59463 | SlogP: 2.71097 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0174997 | Sterimol/B1: 2.19603 | Sterimol/B2: 2.8607 | Sterimol/B3: 4.4603 | |||
| Sterimol/B4: 13.2221 | Sterimol/L: 25.0402 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 879.452 | Positive charged surface: 514.495 | Negative charged surface: 364.958 | Volume: 483.625 | |||
| Hydrophobic surface: 631.661 | Hydrophilic surface: 247.791 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 0 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
