 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(N)c1ccc(NC(=O)C(NC(=O)c2ccccc2C)CC(C)C)cc1 |
| InChI: | InChI=1/C20H25N3O4S/c1-13(2)12-18(23-19(24)17-7-5-4-6-14(17)3)20(25)22-15-8-10-16(11-9-15)28(21,26)27/h4-11,13,18H,12H2,1-3H3,(H,22,25)(H,23,24)(H2,21,26,27)/t18-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=95.0135 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 403.503 g/mol | logS: -5.78739 | SlogP: 2.42562 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0814623 | Sterimol/B1: 2.37804 | Sterimol/B2: 4.37571 | Sterimol/B3: 5.84756 | |||
| Sterimol/B4: 6.05383 | Sterimol/L: 18.8688 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 660.276 | Positive charged surface: 382.102 | Negative charged surface: 278.174 | Volume: 371.5 | |||
| Hydrophobic surface: 446.145 | Hydrophilic surface: 214.131 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
