Type: Neutral
Formula: C21H19N5O3S3
SMILES: |
s1c2c(nc1SCCCC(=O)Nc1ccc(S(=O)(=O)Nc3ncccn3)cc1)cccc2 |
InChI: |
InChI=1/C21H19N5O3S3/c27-19(7-3-14-30-21-25-17-5-1-2-6-18(17)31-21)24-15-8-10-16(11-9-15)32(28,29)26-20-22-12-4-13-23-20/h1-2,4-6,8-13H,3,7,14H2,(H,24,27)(H,22,23,26) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 485.613 g/mol | logS: -6.93969 | SlogP: 4.3981 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0139564 | Sterimol/B1: 3.22958 | Sterimol/B2: 3.90694 | Sterimol/B3: 4.96798 |
Sterimol/B4: 5.42184 | Sterimol/L: 24.819 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 761.284 | Positive charged surface: 427.063 | Negative charged surface: 334.221 | Volume: 413.75 |
Hydrophobic surface: 530.314 | Hydrophilic surface: 230.97 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |