Type: Ionized
Formula: C9H15O9-
| SMILES: |
O1C(C(O)C(O)CO)C(O)C(O)CC1(O)C(=O)[O-] |
| InChI: |
InChI=1/C9H16O9/c10-2-4(12)6(14)7-5(13)3(11)1-9(17,18-7)8(15)16/h3-7,10-14,17H,1-2H2,(H,15,16)/p-1/t3-,4+,5+,6-,7+,9-/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 267.21 g/mol | logS: 0.8192 | SlogP: -5.3503 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.125291 | Sterimol/B1: 3.24769 | Sterimol/B2: 3.61802 | Sterimol/B3: 4.7898 |
| Sterimol/B4: 5.15575 | Sterimol/L: 12.0773 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 429.86 | Positive charged surface: 267.557 | Negative charged surface: 162.303 | Volume: 212.375 |
| Hydrophobic surface: 137.105 | Hydrophilic surface: 292.755 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 2 | Basic groups: 0 |
| Chiral centers: 6 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
| |
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|