Type: Neutral
Formula: C3H11NO6P2
SMILES: |
P(O)(O)(=O)C(P(O)(O)=O)(N)CC |
InChI: |
InChI=1/C3H11NO6P2/c1-2-3(4,11(5,6)7)12(8,9)10/h2,4H2,1H3,(H2,5,6,7)(H2,8,9,10) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 219.07 g/mol | logS: 1.41624 | SlogP: -2.7761 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.373463 | Sterimol/B1: 2.40702 | Sterimol/B2: 3.4314 | Sterimol/B3: 4.00652 |
Sterimol/B4: 5.90825 | Sterimol/L: 8.93384 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 348.511 | Positive charged surface: 196.772 | Negative charged surface: 151.739 | Volume: 158.375 |
Hydrophobic surface: 68.5427 | Hydrophilic surface: 279.9683 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |