 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1cc(ccc1)C(CC(=O)NCC[NH+]1CCCC1)c1c2c([nH]c1)cccc2 |
| InChI: | InChI=1/C24H29N3O2/c1-29-19-8-6-7-18(15-19)21(22-17-26-23-10-3-2-9-20(22)23)16-24(28)25-11-14-27-12-4-5-13-27/h2-3,6-10,15,17,21,26H,4-5,11-14,16H2,1H3,(H,25,28)/p+1/t21-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=65.1156 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 392.523 g/mol | logS: -3.88302 | SlogP: 2.4934 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0818128 | Sterimol/B1: 2.30518 | Sterimol/B2: 3.9253 | Sterimol/B3: 6.12594 | |||
| Sterimol/B4: 7.37996 | Sterimol/L: 19.347 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 701.715 | Positive charged surface: 516.076 | Negative charged surface: 184.826 | Volume: 407.625 | |||
| Hydrophobic surface: 588.772 | Hydrophilic surface: 112.943 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
