 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCCC1Cn1c2c(nc1CNC(=O)C(C)C)cc(cc2)C(=O)[O-] |
| InChI: | InChI=1/C18H23N3O4/c1-11(2)17(22)19-9-16-20-14-8-12(18(23)24)5-6-15(14)21(16)10-13-4-3-7-25-13/h5-6,8,11,13H,3-4,7,9-10H2,1-2H3,(H,19,22)(H,23,24)/p-1/t13-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=29.6228 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 344.391 g/mol | logS: -3.01231 | SlogP: 1.3838 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0546104 | Sterimol/B1: 2.22342 | Sterimol/B2: 4.36325 | Sterimol/B3: 6.5265 | |||
| Sterimol/B4: 8.28649 | Sterimol/L: 15.0836 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 615.623 | Positive charged surface: 394.219 | Negative charged surface: 221.403 | Volume: 330.25 | |||
| Hydrophobic surface: 426.566 | Hydrophilic surface: 189.057 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
