 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCCC1Cn1c2c(nc1C(NC(=O)NCCC)C)cc(cc2)C(=O)[O-] |
| InChI: | InChI=1/C19H26N4O4/c1-3-8-20-19(26)21-12(2)17-22-15-10-13(18(24)25)6-7-16(15)23(17)11-14-5-4-9-27-14/h6-7,10,12,14H,3-5,8-9,11H2,1-2H3,(H,24,25)(H2,20,21,26)/p-1/t12-,14+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=3.05936 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 373.433 g/mol | logS: -3.29882 | SlogP: 1.7109 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.125133 | Sterimol/B1: 2.98823 | Sterimol/B2: 6.26946 | Sterimol/B3: 6.91463 | |||
| Sterimol/B4: 7.31411 | Sterimol/L: 17.1657 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 673.915 | Positive charged surface: 451.862 | Negative charged surface: 222.053 | Volume: 360.875 | |||
| Hydrophobic surface: 461.077 | Hydrophilic surface: 212.838 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
