 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCCC1Cn1c2c(nc1C(NC(=O)NC(C)C)C)cc(cc2)C(=O)[O-] |
| InChI: | InChI=1/C19H26N4O4/c1-11(2)20-19(26)21-12(3)17-22-15-9-13(18(24)25)6-7-16(15)23(17)10-14-5-4-8-27-14/h6-7,9,11-12,14H,4-5,8,10H2,1-3H3,(H,24,25)(H2,20,21,26)/p-1/t12-,14-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=5.05212 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 373.433 g/mol | logS: -3.42426 | SlogP: 1.7093 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.106838 | Sterimol/B1: 3.8698 | Sterimol/B2: 4.81321 | Sterimol/B3: 6.82284 | |||
| Sterimol/B4: 7.76356 | Sterimol/L: 16.5725 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 655.073 | Positive charged surface: 426.541 | Negative charged surface: 228.532 | Volume: 360 | |||
| Hydrophobic surface: 435.196 | Hydrophilic surface: 219.877 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
