Type: Neutral
Formula: C18H24N4O2S
SMILES: |
s1c(nnc1NC(=O)C(NC(=O)CCC)C(CC)C)-c1ccccc1 |
InChI: |
InChI=1/C18H24N4O2S/c1-4-9-14(23)19-15(12(3)5-2)16(24)20-18-22-21-17(25-18)13-10-7-6-8-11-13/h6-8,10-12,15H,4-5,9H2,1-3H3,(H,19,23)(H,20,22,24)/t12-,15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 360.482 g/mol | logS: -6.35373 | SlogP: 3.4746 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0457731 | Sterimol/B1: 2.51455 | Sterimol/B2: 3.34561 | Sterimol/B3: 4.50588 |
Sterimol/B4: 7.12576 | Sterimol/L: 20.9262 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 633.872 | Positive charged surface: 380.312 | Negative charged surface: 253.56 | Volume: 348 |
Hydrophobic surface: 470.167 | Hydrophilic surface: 163.705 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |