Type: Neutral
Formula: C20H28N4O2S
SMILES: |
s1c(nnc1NC(=O)C(NC(=O)C(C)(C)C)C(CC)C)-c1ccc(cc1)C |
InChI: |
InChI=1/C20H28N4O2S/c1-7-13(3)15(21-18(26)20(4,5)6)16(25)22-19-24-23-17(27-19)14-10-8-12(2)9-11-14/h8-11,13,15H,7H2,1-6H3,(H,21,26)(H,22,24,25)/t13-,15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 388.536 g/mol | logS: -6.71597 | SlogP: 4.02902 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0433028 | Sterimol/B1: 2.04869 | Sterimol/B2: 2.57363 | Sterimol/B3: 5.07663 |
Sterimol/B4: 8.46123 | Sterimol/L: 20.5427 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 681.537 | Positive charged surface: 402.436 | Negative charged surface: 279.1 | Volume: 382 |
Hydrophobic surface: 490.527 | Hydrophilic surface: 191.01 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |