Type: Neutral
Formula: C19H27FN2O2S
SMILES: |
S1CC(N(C(=O)C(C)C)C1c1cc(F)ccc1)C(=O)NCCCCC |
InChI: |
InChI=1/C19H27FN2O2S/c1-4-5-6-10-21-17(23)16-12-25-19(22(16)18(24)13(2)3)14-8-7-9-15(20)11-14/h7-9,11,13,16,19H,4-6,10,12H2,1-3H3,(H,21,23)/t16-,19+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 366.501 g/mol | logS: -4.88434 | SlogP: 3.8262 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.164301 | Sterimol/B1: 3.89521 | Sterimol/B2: 4.87561 | Sterimol/B3: 5.66408 |
Sterimol/B4: 6.85227 | Sterimol/L: 16.2928 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 636.643 | Positive charged surface: 421.631 | Negative charged surface: 215.012 | Volume: 356.75 |
Hydrophobic surface: 505.847 | Hydrophilic surface: 130.796 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |