Type: Neutral
Formula: C19H26N4O4S
SMILES: |
S1CC(NC12CCN(CC2)C(=O)c1cc([N+](=O)[O-])ccc1)C(=O)NC(CC)C |
InChI: |
InChI=1/C19H26N4O4S/c1-3-13(2)20-17(24)16-12-28-19(21-16)7-9-22(10-8-19)18(25)14-5-4-6-15(11-14)23(26)27/h4-6,11,13,16,21H,3,7-10,12H2,1-2H3,(H,20,24)/t13-,16+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 406.507 g/mol | logS: -4.76001 | SlogP: 2.1468 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0584114 | Sterimol/B1: 2.45254 | Sterimol/B2: 4.64879 | Sterimol/B3: 5.1856 |
Sterimol/B4: 5.83897 | Sterimol/L: 19.9411 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 662.752 | Positive charged surface: 390.745 | Negative charged surface: 272.007 | Volume: 372.625 |
Hydrophobic surface: 433.601 | Hydrophilic surface: 229.151 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |