Type: Neutral
Formula: C20H28N4O4S
SMILES: |
S1CC(NC12CCN(CC2)C(=O)c1cc([N+](=O)[O-])c(cc1)C)C(=O)NC(CC)C |
InChI: |
InChI=1/C20H28N4O4S/c1-4-14(3)21-18(25)16-12-29-20(22-16)7-9-23(10-8-20)19(26)15-6-5-13(2)17(11-15)24(27)28/h5-6,11,14,16,22H,4,7-10,12H2,1-3H3,(H,21,25)/t14-,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 420.534 g/mol | logS: -4.92048 | SlogP: 2.45522 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0656669 | Sterimol/B1: 2.91469 | Sterimol/B2: 3.26382 | Sterimol/B3: 5.74324 |
Sterimol/B4: 7.13272 | Sterimol/L: 19.0198 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 686.048 | Positive charged surface: 415.161 | Negative charged surface: 270.887 | Volume: 390.625 |
Hydrophobic surface: 464.203 | Hydrophilic surface: 221.845 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |