Type: Neutral
Formula: C15H22N2O5
SMILES: |
Oc1ccc(cc1)CC(NC(=O)C(N)C(O)C)C(OCC)=O |
InChI: |
InChI=1/C15H22N2O5/c1-3-22-15(21)12(17-14(20)13(16)9(2)18)8-10-4-6-11(19)7-5-10/h4-7,9,12-13,18-19H,3,8,16H2,1-2H3,(H,17,20)/t9-,12-,13+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 310.35 g/mol | logS: -1.78194 | SlogP: -0.30933 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0942678 | Sterimol/B1: 3.03997 | Sterimol/B2: 3.76716 | Sterimol/B3: 5.04578 |
Sterimol/B4: 7.34674 | Sterimol/L: 15.0589 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 565.853 | Positive charged surface: 371.755 | Negative charged surface: 194.098 | Volume: 295.5 |
Hydrophobic surface: 339.21 | Hydrophilic surface: 226.643 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |