Type: Neutral
Formula: C14H17N3O4
SMILES: |
Oc1cc2c([nH]cc2CC(N)C(=O)NC(C(O)=O)C)cc1 |
InChI: |
InChI=1/C14H17N3O4/c1-7(14(20)21)17-13(19)11(15)4-8-6-16-12-3-2-9(18)5-10(8)12/h2-3,5-7,11,16,18H,4,15H2,1H3,(H,17,19)(H,20,21)/t7-,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 291.307 g/mol | logS: -1.53484 | SlogP: 0.33257 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0468208 | Sterimol/B1: 2.22145 | Sterimol/B2: 3.49482 | Sterimol/B3: 4.00185 |
Sterimol/B4: 5.52104 | Sterimol/L: 16.0564 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 523.364 | Positive charged surface: 322.515 | Negative charged surface: 198.145 | Volume: 266.25 |
Hydrophobic surface: 244.636 | Hydrophilic surface: 278.728 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |