Type: Neutral
Formula: C23H28N2O2
SMILES: |
O(CCCCC)c1ccc(NC(=O)CCCc2c3c([nH]c2)cccc3)cc1 |
InChI: |
InChI=1/C23H28N2O2/c1-2-3-6-16-27-20-14-12-19(13-15-20)25-23(26)11-7-8-18-17-24-22-10-5-4-9-21(18)22/h4-5,9-10,12-15,17,24H,2-3,6-8,11,16H2,1H3,(H,25,26) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 364.489 g/mol | logS: -5.39973 | SlogP: 5.69827 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0335026 | Sterimol/B1: 3.38171 | Sterimol/B2: 4.19995 | Sterimol/B3: 4.38046 |
Sterimol/B4: 5.29505 | Sterimol/L: 23.8268 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 723.831 | Positive charged surface: 492.432 | Negative charged surface: 227.376 | Volume: 381.625 |
Hydrophobic surface: 605.159 | Hydrophilic surface: 118.672 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |