Type: Neutral
Formula: C17H19N3O
SMILES: |
O=C(Nc1c2CCCCc2ccc1)c1[nH]nc(c1)C1CC1 |
InChI: |
InChI=1/C17H19N3O/c21-17(16-10-15(19-20-16)12-8-9-12)18-14-7-3-5-11-4-1-2-6-13(11)14/h3,5,7,10,12H,1-2,4,6,8-9H2,(H,18,21)(H,19,20) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 281.359 g/mol | logS: -4.12151 | SlogP: 3.41814 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0248317 | Sterimol/B1: 2.56246 | Sterimol/B2: 2.92765 | Sterimol/B3: 3.31295 |
Sterimol/B4: 7.37327 | Sterimol/L: 16.6457 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 533.8 | Positive charged surface: 337.108 | Negative charged surface: 196.693 | Volume: 279.75 |
Hydrophobic surface: 400.109 | Hydrophilic surface: 133.691 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |