Type: Neutral
Formula: C19H25N3O3S2
SMILES: |
S1C2C(N=C1Nc1cc(ccc1C)C(=O)NC1CCCCC1)CS(=O)(=O)C2 |
InChI: |
InChI=1/C19H25N3O3S2/c1-12-7-8-13(18(23)20-14-5-3-2-4-6-14)9-15(12)21-19-22-16-10-27(24,25)11-17(16)26-19/h7-9,14,16-17H,2-6,10-11H2,1H3,(H,20,23)(H,21,22)/t16-,17+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 407.559 g/mol | logS: -4.91617 | SlogP: 2.73782 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.052618 | Sterimol/B1: 2.24868 | Sterimol/B2: 3.66483 | Sterimol/B3: 3.72776 |
Sterimol/B4: 10.763 | Sterimol/L: 17.1704 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 663.011 | Positive charged surface: 414.303 | Negative charged surface: 248.708 | Volume: 366.75 |
Hydrophobic surface: 496.546 | Hydrophilic surface: 166.465 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |