Type: Neutral
Formula: C20H27N3O3S2
SMILES: |
S1C2C(N=C1Nc1cc(ccc1C)C(=O)NC1CCCCCC1)CS(=O)(=O)C2 |
InChI: |
InChI=1/C20H27N3O3S2/c1-13-8-9-14(19(24)21-15-6-4-2-3-5-7-15)10-16(13)22-20-23-17-11-28(25,26)12-18(17)27-20/h8-10,15,17-18H,2-7,11-12H2,1H3,(H,21,24)(H,22,23)/t17-,18-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 421.586 g/mol | logS: -5.43139 | SlogP: 3.12792 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0550367 | Sterimol/B1: 2.20764 | Sterimol/B2: 3.61987 | Sterimol/B3: 4.0497 |
Sterimol/B4: 10.8453 | Sterimol/L: 17.5414 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 673.084 | Positive charged surface: 420.623 | Negative charged surface: 252.461 | Volume: 381.875 |
Hydrophobic surface: 507.419 | Hydrophilic surface: 165.665 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |