Type: Neutral
Formula: C21H31N3O4S
SMILES: |
S(=O)(=O)(N1CCCCC1)c1cc2c(n(cc2)CC(=O)NCCCOC(C)C)cc1 |
InChI: |
InChI=1/C21H31N3O4S/c1-17(2)28-14-6-10-22-21(25)16-23-13-9-18-15-19(7-8-20(18)23)29(26,27)24-11-4-3-5-12-24/h7-9,13,15,17H,3-6,10-12,14,16H2,1-2H3,(H,22,25) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 421.562 g/mol | logS: -3.4079 | SlogP: 3.0136 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.026091 | Sterimol/B1: 3.61689 | Sterimol/B2: 4.34677 | Sterimol/B3: 4.67019 |
Sterimol/B4: 5.80134 | Sterimol/L: 23.1198 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 751.791 | Positive charged surface: 515.095 | Negative charged surface: 230.699 | Volume: 408 |
Hydrophobic surface: 589.774 | Hydrophilic surface: 162.017 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |