 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1c2cc(ccc2OC1)CNC(=O)C1CC2[NH+](CCC2)C12c1c(N(C)C2=O)cccc1 |
| InChI: | InChI=1/C24H25N3O4/c1-26-19-7-3-2-6-17(19)24(23(26)29)18(12-16-5-4-10-27(16)24)22(28)25-13-15-8-9-20-21(11-15)31-14-30-20/h2-3,6-9,11,16,18H,4-5,10,12-14H2,1H3,(H,25,28)/p+1/t16-,18+,24+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=70.4638 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 420.489 g/mol | logS: -4.03192 | SlogP: 1.5485 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.126609 | Sterimol/B1: 2.27985 | Sterimol/B2: 3.23317 | Sterimol/B3: 6.36903 | |||
| Sterimol/B4: 7.51568 | Sterimol/L: 17.5058 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 663.242 | Positive charged surface: 469.06 | Negative charged surface: 194.183 | Volume: 398.625 | |||
| Hydrophobic surface: 547.555 | Hydrophilic surface: 115.687 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
