 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1c2cc(ccc2OC1)CNC(=O)C1CC2N(CCC2)C12c1c(N(C)C2=O)cccc1 |
| InChI: | InChI=1/C24H25N3O4/c1-26-19-7-3-2-6-17(19)24(23(26)29)18(12-16-5-4-10-27(16)24)22(28)25-13-15-8-9-20-21(11-15)31-14-30-20/h2-3,6-9,11,16,18H,4-5,10,12-14H2,1H3,(H,25,28)/t16-,18+,24+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=135.633 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 419.481 g/mol | logS: -4.05631 | SlogP: 2.9656 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.126574 | Sterimol/B1: 2.4778 | Sterimol/B2: 4.56595 | Sterimol/B3: 6.57123 | |||
| Sterimol/B4: 6.71951 | Sterimol/L: 17.0066 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 638.289 | Positive charged surface: 439.92 | Negative charged surface: 198.369 | Volume: 390 | |||
| Hydrophobic surface: 526.044 | Hydrophilic surface: 112.245 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
