 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1c2cc(ccc2OC1)CNC(=O)C1CC2[NH+](CCC2)C12c1c(NC2=O)cccc1 |
| InChI: | InChI=1/C23H23N3O4/c27-21(24-12-14-7-8-19-20(10-14)30-13-29-19)17-11-15-4-3-9-26(15)23(17)16-5-1-2-6-18(16)25-22(23)28/h1-2,5-8,10,15,17H,3-4,9,11-13H2,(H,24,27)(H,25,28)/p+1/t15-,17-,23+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=67.2197 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 406.462 g/mol | logS: -4.13791 | SlogP: 1.5242 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.147571 | Sterimol/B1: 2.50536 | Sterimol/B2: 3.34309 | Sterimol/B3: 6.52887 | |||
| Sterimol/B4: 6.99759 | Sterimol/L: 16.7849 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 609.722 | Positive charged surface: 431.863 | Negative charged surface: 177.859 | Volume: 381.125 | |||
| Hydrophobic surface: 447.775 | Hydrophilic surface: 161.947 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
