Type: Neutral
Formula: C19H21N3O4S
SMILES: |
S(=O)(=O)(CCC(N1Cc2c(cccc2)C1=O)C(=O)Nc1nccc(c1)C)C |
InChI: |
InChI=1/C19H21N3O4S/c1-13-7-9-20-17(11-13)21-18(23)16(8-10-27(2,25)26)22-12-14-5-3-4-6-15(14)19(22)24/h3-7,9,11,16H,8,10,12H2,1-2H3,(H,20,21,23)/t16-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 387.46 g/mol | logS: -3.38383 | SlogP: 2.05422 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0742035 | Sterimol/B1: 3.76431 | Sterimol/B2: 4.08833 | Sterimol/B3: 5.56759 |
Sterimol/B4: 6.93751 | Sterimol/L: 17.0049 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 647.115 | Positive charged surface: 387.86 | Negative charged surface: 259.255 | Volume: 349.625 |
Hydrophobic surface: 507.925 | Hydrophilic surface: 139.19 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |