Type: Neutral
Formula: C14H17N3O4S2
SMILES: |
s1cccc1C1=NS(=O)(=O)N(C)C(=C1)C(=O)NCC1OCCC1 |
InChI: |
InChI=1/C14H17N3O4S2/c1-17-12(14(18)15-9-10-4-2-6-21-10)8-11(16-23(17,19)20)13-5-3-7-22-13/h3,5,7-8,10H,2,4,6,9H2,1H3,(H,15,18)/t10-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 355.439 g/mol | logS: -3.17499 | SlogP: 0.9065 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0456668 | Sterimol/B1: 2.24001 | Sterimol/B2: 2.24957 | Sterimol/B3: 4.67956 |
Sterimol/B4: 10.2581 | Sterimol/L: 15.0196 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 580.552 | Positive charged surface: 342.592 | Negative charged surface: 237.96 | Volume: 301.5 |
Hydrophobic surface: 445.965 | Hydrophilic surface: 134.587 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |