 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N=C2N(N(c3c2cccc3)C(CC)C(=O)NC2CCCCC2C)C(=C1)C |
| InChI: | InChI=1/C22H28N4O2/c1-4-18(22(28)23-17-11-7-5-9-14(17)2)26-19-12-8-6-10-16(19)21-24-20(27)13-15(3)25(21)26/h6,8,10,12-14,17-18H,4-5,7,9,11H2,1-3H3,(H,23,28)/t14-,17-,18-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=133.841 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 380.492 g/mol | logS: -4.96036 | SlogP: 3.3877 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.193047 | Sterimol/B1: 2.56275 | Sterimol/B2: 4.36842 | Sterimol/B3: 7.53744 | |||
| Sterimol/B4: 7.53921 | Sterimol/L: 16.1622 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 632.47 | Positive charged surface: 404.464 | Negative charged surface: 228.006 | Volume: 377.375 | |||
| Hydrophobic surface: 497.562 | Hydrophilic surface: 134.908 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.