Type: Neutral
Formula: C20H24N4O3
SMILES: |
O1CCCC1CNC(=O)C(N1N2C(=NC(=O)C=C2C)c2c1cccc2)CC |
InChI: |
InChI=1/C20H24N4O3/c1-3-16(20(26)21-12-14-7-6-10-27-14)24-17-9-5-4-8-15(17)19-22-18(25)11-13(2)23(19)24/h4-5,8-9,11,14,16H,3,6-7,10,12H2,1-2H3,(H,21,26)/t14-,16-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 368.437 g/mol | logS: -3.98247 | SlogP: 1.988 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.136089 | Sterimol/B1: 2.41779 | Sterimol/B2: 5.41378 | Sterimol/B3: 6.26371 |
Sterimol/B4: 6.78566 | Sterimol/L: 16.7907 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 625.327 | Positive charged surface: 401.571 | Negative charged surface: 223.756 | Volume: 352.25 |
Hydrophobic surface: 489.758 | Hydrophilic surface: 135.569 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |