 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC1CCCCC1)C(N1CC(CCC1)C)c1ccccc1 |
| InChI: | InChI=1/C20H30N2O/c1-16-9-8-14-22(15-16)19(17-10-4-2-5-11-17)20(23)21-18-12-6-3-7-13-18/h2,4-5,10-11,16,18-19H,3,6-9,12-15H2,1H3,(H,21,23)/t16-,19-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=70.969 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 314.473 g/mol | logS: -3.85596 | SlogP: 4.004 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0748034 | Sterimol/B1: 3.68671 | Sterimol/B2: 3.85891 | Sterimol/B3: 5.18557 | |||
| Sterimol/B4: 7.01276 | Sterimol/L: 16.1746 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 589.613 | Positive charged surface: 442.549 | Negative charged surface: 147.064 | Volume: 338.5 | |||
| Hydrophobic surface: 549.714 | Hydrophilic surface: 39.899 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
