Type: Neutral
Formula: C19H20N4O3S2
SMILES: |
s1nc2c(n1)cccc2S(=O)(=O)N1CCCC1C(=O)Nc1cc(cc(c1)C)C |
InChI: |
InChI=1/C19H20N4O3S2/c1-12-9-13(2)11-14(10-12)20-19(24)16-6-4-8-23(16)28(25,26)17-7-3-5-15-18(17)22-27-21-15/h3,5,7,9-11,16H,4,6,8H2,1-2H3,(H,20,24)/t16-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 416.526 g/mol | logS: -5.30484 | SlogP: 3.09994 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.128098 | Sterimol/B1: 3.09621 | Sterimol/B2: 4.28264 | Sterimol/B3: 4.6789 |
Sterimol/B4: 7.31571 | Sterimol/L: 16.4045 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 642.491 | Positive charged surface: 403.6 | Negative charged surface: 238.891 | Volume: 364.625 |
Hydrophobic surface: 477.37 | Hydrophilic surface: 165.121 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |