Type: Neutral
Formula: C19H20N4O3S2
SMILES: |
s1nc2c(n1)cccc2S(=O)(=O)N1CCCC1C(=O)NC(C)c1ccccc1 |
InChI: |
InChI=1/C19H20N4O3S2/c1-13(14-7-3-2-4-8-14)20-19(24)16-10-6-12-23(16)28(25,26)17-11-5-9-15-18(17)22-27-21-15/h2-5,7-9,11,13,16H,6,10,12H2,1H3,(H,20,24)/t13-,16+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 416.526 g/mol | logS: -4.62825 | SlogP: 2.8173 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.114555 | Sterimol/B1: 3.41081 | Sterimol/B2: 3.4939 | Sterimol/B3: 5.11991 |
Sterimol/B4: 8.27172 | Sterimol/L: 15.7994 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 633.446 | Positive charged surface: 386.599 | Negative charged surface: 246.847 | Volume: 363.75 |
Hydrophobic surface: 456.769 | Hydrophilic surface: 176.677 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |