Type: Neutral
Formula: C18H18N4O3S2
SMILES: |
s1ccnc1NC(=O)C1CCCN(S(=O)(=O)c2c3ncccc3ccc2)C1 |
InChI: |
InChI=1/C18H18N4O3S2/c23-17(21-18-20-9-11-26-18)14-6-3-10-22(12-14)27(24,25)15-7-1-4-13-5-2-8-19-16(13)15/h1-2,4-5,7-9,11,14H,3,6,10,12H2,(H,20,21,23)/t14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 402.499 g/mol | logS: -3.66364 | SlogP: 2.7307 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0771814 | Sterimol/B1: 2.55171 | Sterimol/B2: 4.06914 | Sterimol/B3: 4.19092 |
Sterimol/B4: 8.06081 | Sterimol/L: 17.8779 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 609.881 | Positive charged surface: 360.652 | Negative charged surface: 243.693 | Volume: 345.625 |
Hydrophobic surface: 488.36 | Hydrophilic surface: 121.521 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |