Type: Neutral
Formula: C19H26N2O2
SMILES: |
O=C1N(CCC1)c1cc(ccc1)C(=O)NC1CCCC(C)C1C |
InChI: |
InChI=1/C19H26N2O2/c1-13-6-3-9-17(14(13)2)20-19(23)15-7-4-8-16(12-15)21-11-5-10-18(21)22/h4,7-8,12-14,17H,3,5-6,9-11H2,1-2H3,(H,20,23)/t13-,14-,17+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 314.429 g/mol | logS: -4.04777 | SlogP: 3.3679 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0384156 | Sterimol/B1: 2.42684 | Sterimol/B2: 4.47762 | Sterimol/B3: 4.65159 |
Sterimol/B4: 4.79305 | Sterimol/L: 18.0225 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 573.806 | Positive charged surface: 391.352 | Negative charged surface: 182.454 | Volume: 320.75 |
Hydrophobic surface: 467.752 | Hydrophilic surface: 106.054 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |