Type: Neutral
Formula: C17H19N3O4S2
SMILES: |
s1ccnc1NC(=O)CCS(=O)(=O)c1cc2CCN(c2cc1)C(=O)CC |
InChI: |
InChI=1/C17H19N3O4S2/c1-2-16(22)20-8-5-12-11-13(3-4-14(12)20)26(23,24)10-6-15(21)19-17-18-7-9-25-17/h3-4,7,9,11H,2,5-6,8,10H2,1H3,(H,18,19,21) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 393.488 g/mol | logS: -3.36439 | SlogP: 2.24467 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0611545 | Sterimol/B1: 3.08511 | Sterimol/B2: 3.19994 | Sterimol/B3: 5.32943 |
Sterimol/B4: 7.01667 | Sterimol/L: 21.0831 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 643.49 | Positive charged surface: 391.205 | Negative charged surface: 252.285 | Volume: 340 |
Hydrophobic surface: 464.05 | Hydrophilic surface: 179.44 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |