Type: Neutral
Formula: C18H24N4O3S
SMILES: |
S(=O)(=O)(N1CC(CCC1)C(=O)Nc1ccc(cc1)C(C)C)c1nc[nH]c1 |
InChI: |
InChI=1/C18H24N4O3S/c1-13(2)14-5-7-16(8-6-14)21-18(23)15-4-3-9-22(11-15)26(24,25)17-10-19-12-20-17/h5-8,10,12-13,15H,3-4,9,11H2,1-2H3,(H,19,20)(H,21,23)/t15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 376.481 g/mol | logS: -4.02357 | SlogP: 2.5725 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0441461 | Sterimol/B1: 2.40717 | Sterimol/B2: 5.02823 | Sterimol/B3: 5.08724 |
Sterimol/B4: 5.35649 | Sterimol/L: 19.3469 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 639.161 | Positive charged surface: 431.375 | Negative charged surface: 207.786 | Volume: 348.375 |
Hydrophobic surface: 450.294 | Hydrophilic surface: 188.867 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |