 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | s1c-2c(cc1C(=O)NCC1N(CCC1)CC)C(=O)Nc1c-2cccc1 |
| InChI: | InChI=1/C19H21N3O2S/c1-2-22-9-5-6-12(22)11-20-19(24)16-10-14-17(25-16)13-7-3-4-8-15(13)21-18(14)23/h3-4,7-8,10,12H,2,5-6,9,11H2,1H3,(H,20,24)(H,21,23)/t12-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=68.3545 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 355.462 g/mol | logS: -4.83483 | SlogP: 3.1949 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0172926 | Sterimol/B1: 2.50229 | Sterimol/B2: 3.62218 | Sterimol/B3: 3.98613 | |||
| Sterimol/B4: 6.23241 | Sterimol/L: 18.3572 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 605.847 | Positive charged surface: 369.259 | Negative charged surface: 236.588 | Volume: 334.5 | |||
| Hydrophobic surface: 470.334 | Hydrophilic surface: 135.513 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
