Type: Neutral
Formula: C18H25N5O3S
SMILES: |
S(=O)(=O)(N1CC(CCC1)C(=O)NCc1ccc(N(C)C)cc1)c1nc[nH]c1 |
InChI: |
InChI=1/C18H25N5O3S/c1-22(2)16-7-5-14(6-8-16)10-20-18(24)15-4-3-9-23(12-15)27(25,26)17-11-19-13-21-17/h5-8,11,13,15H,3-4,9-10,12H2,1-2H3,(H,19,21)(H,20,24)/t15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 391.496 g/mol | logS: -2.39066 | SlogP: 1.4592 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0449908 | Sterimol/B1: 2.68525 | Sterimol/B2: 3.74856 | Sterimol/B3: 5.21519 |
Sterimol/B4: 5.21806 | Sterimol/L: 20.9993 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 670.411 | Positive charged surface: 489.297 | Negative charged surface: 181.114 | Volume: 360.75 |
Hydrophobic surface: 508.142 | Hydrophilic surface: 162.269 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |