Type: Neutral
Formula: C22H28N2OS
SMILES: |
S(CC(=O)NC1CCCCCC1)c1c2CCCCc2nc2c1cccc2 |
InChI: |
InChI=1/C22H28N2OS/c25-21(23-16-9-3-1-2-4-10-16)15-26-22-17-11-5-7-13-19(17)24-20-14-8-6-12-18(20)22/h5,7,11,13,16H,1-4,6,8-10,12,14-15H2,(H,23,25) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 368.545 g/mol | logS: -6.24256 | SlogP: 5.04464 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0464235 | Sterimol/B1: 2.46176 | Sterimol/B2: 3.47054 | Sterimol/B3: 3.74501 |
Sterimol/B4: 9.68382 | Sterimol/L: 17.3107 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 644.53 | Positive charged surface: 445.9 | Negative charged surface: 194.51 | Volume: 370 |
Hydrophobic surface: 568.209 | Hydrophilic surface: 76.321 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |