Type: Neutral
Formula: C22H21FN2OS
SMILES: |
S(CC(=O)NCc1ccc(F)cc1)c1c2CCCCc2nc2c1cccc2 |
InChI: |
InChI=1/C22H21FN2OS/c23-16-11-9-15(10-12-16)13-24-21(26)14-27-22-17-5-1-3-7-19(17)25-20-8-4-2-6-18(20)22/h1,3,5,7,9-12H,2,4,6,8,13-14H2,(H,24,26) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 380.487 g/mol | logS: -6.31908 | SlogP: 4.92754 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0669456 | Sterimol/B1: 2.44999 | Sterimol/B2: 4.07848 | Sterimol/B3: 4.13247 |
Sterimol/B4: 9.69513 | Sterimol/L: 17.1508 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 653.477 | Positive charged surface: 388.623 | Negative charged surface: 260.734 | Volume: 359.375 |
Hydrophobic surface: 563.111 | Hydrophilic surface: 90.366 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |