Type: Neutral
Formula: C21H26N2OS
SMILES: |
S(CC(=O)NC1CCCCC1)c1c2CCCCc2nc2c1cccc2 |
InChI: |
InChI=1/C21H26N2OS/c24-20(22-15-8-2-1-3-9-15)14-25-21-16-10-4-6-12-18(16)23-19-13-7-5-11-17(19)21/h4,6,10,12,15H,1-3,5,7-9,11,13-14H2,(H,22,24) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 354.518 g/mol | logS: -5.72734 | SlogP: 4.65454 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.041616 | Sterimol/B1: 2.42734 | Sterimol/B2: 3.20491 | Sterimol/B3: 3.91239 |
Sterimol/B4: 9.67352 | Sterimol/L: 16.949 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 629.878 | Positive charged surface: 436.322 | Negative charged surface: 189.436 | Volume: 353 |
Hydrophobic surface: 552.389 | Hydrophilic surface: 77.489 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |