Type: Neutral
Formula: C19H20N4O3S2
SMILES: |
s1c2cc(ccc2nc1NC(=O)C1CCCN(S(=O)(=O)c2cccnc2)C1)C |
InChI: |
InChI=1/C19H20N4O3S2/c1-13-6-7-16-17(10-13)27-19(21-16)22-18(24)14-4-3-9-23(12-14)28(25,26)15-5-2-8-20-11-15/h2,5-8,10-11,14H,3-4,9,12H2,1H3,(H,21,22,24)/t14-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 416.526 g/mol | logS: -4.10636 | SlogP: 3.03912 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0718055 | Sterimol/B1: 4.13394 | Sterimol/B2: 4.82985 | Sterimol/B3: 5.03428 |
Sterimol/B4: 5.39267 | Sterimol/L: 18.6693 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 650.301 | Positive charged surface: 389.188 | Negative charged surface: 261.112 | Volume: 365.25 |
Hydrophobic surface: 512.067 | Hydrophilic surface: 138.234 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |