 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(Cc1ccc(cc1)C(=O)NC1CCCc2c1cccc2)c1nc2-c(n1)c[nH]cc2 |
| InChI: | InChI=1/C24H22N4OS/c29-23(26-20-7-3-5-17-4-1-2-6-19(17)20)18-10-8-16(9-11-18)15-30-24-27-21-12-13-25-14-22(21)28-24/h1-2,4,6,8-14,20,25H,3,5,7,15H2,(H,26,29)/t20-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=122.83 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 414.533 g/mol | logS: -6.75237 | SlogP: 5.37107 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0351045 | Sterimol/B1: 2.50812 | Sterimol/B2: 3.65367 | Sterimol/B3: 4.63725 | |||
| Sterimol/B4: 7.49649 | Sterimol/L: 22.2147 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 703.716 | Positive charged surface: 399.019 | Negative charged surface: 304.697 | Volume: 398.125 | |||
| Hydrophobic surface: 581.391 | Hydrophilic surface: 122.325 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
