Type: Neutral
Formula: C18H22N2O3S2
SMILES: |
s1cccc1S(=O)(=O)N1CC(CCC1)C(=O)NCc1ccc(cc1)C |
InChI: |
InChI=1/C18H22N2O3S2/c1-14-6-8-15(9-7-14)12-19-18(21)16-4-2-10-20(13-16)25(22,23)17-5-3-11-24-17/h3,5-9,11,16H,2,4,10,12-13H2,1H3,(H,19,21)/t16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 378.517 g/mol | logS: -3.9867 | SlogP: 3.04002 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0467212 | Sterimol/B1: 3.75187 | Sterimol/B2: 4.05432 | Sterimol/B3: 4.47036 |
Sterimol/B4: 4.66407 | Sterimol/L: 20.3172 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 637.429 | Positive charged surface: 356.155 | Negative charged surface: 281.273 | Volume: 345.75 |
Hydrophobic surface: 539.438 | Hydrophilic surface: 97.991 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |