Type: Neutral
Formula: C18H19N5O4S
SMILES: |
S(=O)(=O)(N1CC(CCC1)C(=O)NCc1cccnc1)c1c2nonc2ccc1 |
InChI: |
InChI=1/C18H19N5O4S/c24-18(20-11-13-4-2-8-19-10-13)14-5-3-9-23(12-14)28(25,26)16-7-1-6-15-17(16)22-27-21-15/h1-2,4,6-8,10,14H,3,5,9,11-12H2,(H,20,24)/t14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 401.447 g/mol | logS: -2.74428 | SlogP: 1.6013 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0537226 | Sterimol/B1: 2.5308 | Sterimol/B2: 3.54228 | Sterimol/B3: 4.38897 |
Sterimol/B4: 7.19969 | Sterimol/L: 19.1344 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 622.483 | Positive charged surface: 393.981 | Negative charged surface: 228.502 | Volume: 345.375 |
Hydrophobic surface: 431.229 | Hydrophilic surface: 191.254 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |