 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Fc1cc(NC(=O)C2CCC(=O)N(C2c2ccc(OC)cc2)c2cc3OCOc3cc2)ccc1C |
| InChI: | InChI=1/C27H25FN2O5/c1-16-3-6-18(13-22(16)28)29-27(32)21-10-12-25(31)30(19-7-11-23-24(14-19)35-15-34-23)26(21)17-4-8-20(33-2)9-5-17/h3-9,11,13-14,21,26H,10,12,15H2,1-2H3,(H,29,32)/t21-,26-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=164.14 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 476.504 g/mol | logS: -5.69525 | SlogP: 5.08992 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.251481 | Sterimol/B1: 2.82878 | Sterimol/B2: 6.82752 | Sterimol/B3: 6.90948 | |||
| Sterimol/B4: 7.26325 | Sterimol/L: 17.5721 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 708.737 | Positive charged surface: 480.931 | Negative charged surface: 227.806 | Volume: 433 | |||
| Hydrophobic surface: 596.237 | Hydrophilic surface: 112.5 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.