 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Fc1ccc(NC(=O)C2CCC(=O)N(C2c2ccc(OC)cc2)c2cc3OCOc3cc2)cc1 |
| InChI: | InChI=1/C26H23FN2O5/c1-32-20-9-2-16(3-10-20)25-21(26(31)28-18-6-4-17(27)5-7-18)11-13-24(30)29(25)19-8-12-22-23(14-19)34-15-33-22/h2-10,12,14,21,25H,11,13,15H2,1H3,(H,28,31)/t21-,25+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=147.956 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 462.477 g/mol | logS: -5.53478 | SlogP: 4.7815 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.164248 | Sterimol/B1: 2.55467 | Sterimol/B2: 3.09678 | Sterimol/B3: 5.89924 | |||
| Sterimol/B4: 10.8655 | Sterimol/L: 17.752 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 706.881 | Positive charged surface: 464.599 | Negative charged surface: 242.281 | Volume: 418.25 | |||
| Hydrophobic surface: 591.431 | Hydrophilic surface: 115.45 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.