Type: Neutral
Formula: C12H18N6O4
SMILES: |
O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1N(C)C |
InChI: |
InChI=1/C12H18N6O4/c1-17(2)12-16-6-9(13)14-4-15-10(6)18(12)11-8(21)7(20)5(3-19)22-11/h4-5,7-8,11,19-21H,3H2,1-2H3,(H2,13,14,15)/t5-,7+,8+,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 310.314 g/mol | logS: -1.49183 | SlogP: -1.8185 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.181442 | Sterimol/B1: 2.54788 | Sterimol/B2: 3.3324 | Sterimol/B3: 5.01771 |
Sterimol/B4: 8.21279 | Sterimol/L: 12.2902 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 524.452 | Positive charged surface: 452.817 | Negative charged surface: 71.6349 | Volume: 269.75 |
Hydrophobic surface: 260.972 | Hydrophilic surface: 263.48 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |